CAS 1329834-37-8 appears in our catalog under these names: 3-Methyl Methcathinone-d3 Hydrochloride, >95% (HPLC), 3-Methyl methcathinone-d3 hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
1-(3-methylphenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride (CAS 1329834-37-8) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 216.72 g/mol. IUPAC name: 1-(3-methylphenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride. InChIKey: RPFQEIQTWQWCQH-FJCVKDQNSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 216.72 g/mol |
| IUPAC name | 1-(3-methylphenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride |
| InChIKey | RPFQEIQTWQWCQH-FJCVKDQNSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)C(=O)C1=CC=CC(=C1)C.Cl |
Computed by PubChem (NCBI)