CAS 1329835-64-4 appears in our catalog under these names: Tolnaftate-d7, Tolnaftate–d7. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 50mg, 500μg, 1mg, 25mg, 10mg, 500 μg, 1 mg.
O-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl) N-methyl-N-(3-methylphenyl)carbamothioate (CAS 1329835-64-4) is a chemical compound with the molecular formula C19H17NOS and a molecular weight of 314.5 g/mol. IUPAC name: O-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl) N-methyl-N-(3-methylphenyl)carbamothioate. InChIKey: FUSNMLFNXJSCDI-BTSZWIDXSA-N.
| Molecular formula | C19H17NOS |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | O-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl) N-methyl-N-(3-methylphenyl)carbamothioate |
| InChIKey | FUSNMLFNXJSCDI-BTSZWIDXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])OC(=S)N(C)C3=CC=CC(=C3)C)[2H])[2H])[2H] |
Computed by PubChem (NCBI)