CAS 98660-86-7 appears in our catalog under these names: 5-(Di-p-tolylamino)thiophene-2-carbaldehyde 99%, 5-(Di-p-tolylamino)thiophene-2-carbaldehyde, 99%, 99%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-methyl-N-(4-methylphenyl)anilino)thiophene-2-carbaldehyde (CAS 98660-86-7) is a chemical compound with the molecular formula C19H17NOS and a molecular weight of 307.4 g/mol. IUPAC name: 5-(4-methyl-N-(4-methylphenyl)anilino)thiophene-2-carbaldehyde. InChIKey: KIDANXQJPSEATQ-UHFFFAOYSA-N.
| Molecular formula | C19H17NOS |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 5-(4-methyl-N-(4-methylphenyl)anilino)thiophene-2-carbaldehyde |
| InChIKey | KIDANXQJPSEATQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(S3)C=O |
Computed by PubChem (NCBI)