Products 1329836-38-5
CAS 1329836-38-5 appears in our catalog under these names: 4-Ethyl-pyridine-2-carboxylic Acid-d5 Hydrochloride, 4-Ethylpicolinic acid-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3,5,6-trideuterio-4-(1,1-dideuterioethyl)pyridine-2-carboxylic acid;hydrochloride (CAS 1329836-38-5) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 192.65 g/mol. IUPAC name: 3,5,6-trideuterio-4-(1,1-dideuterioethyl)pyridine-2-carboxylic acid;hydrochloride. InChIKey: UUVIZQWGMATQNB-STCCUYJISA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 192.65 g/mol |
| IUPAC name | 3,5,6-trideuterio-4-(1,1-dideuterioethyl)pyridine-2-carboxylic acid;hydrochloride |
| InChIKey | UUVIZQWGMATQNB-STCCUYJISA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C([2H])([2H])C)[2H])C(=O)O)[2H].Cl |
Computed by PubChem (NCBI)