CAS 132991-24-3 appears in our catalog under these names: 4-(4-tert-Butylphenoxymethyl)benzoic acid, 95%, 4-((4-(tert-butyl)phenoxy)methyl)benzoic acid, 95+%, 4-(4-tert-Butyl-phenoxymethyl)-benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
4-[(4-tert-butylphenoxy)methyl]benzoic acid (CAS 132991-24-3) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: 4-[(4-tert-butylphenoxy)methyl]benzoic acid. InChIKey: JVJSNLQHNQFVGD-UHFFFAOYSA-N.
| Molecular formula | C18H20O3 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 4-[(4-tert-butylphenoxy)methyl]benzoic acid |
| InChIKey | JVJSNLQHNQFVGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)