CAS 80183-15-9 is the registry number for (2R,3R)-2,3-Bis(benzyloxymethyl)oxirane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2R,3R)-2,3-bis(phenylmethoxymethyl)oxirane (CAS 80183-15-9) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: (2R,3R)-2,3-bis(phenylmethoxymethyl)oxirane. InChIKey: BWXXSADMQUTHRY-QZTJIDSGSA-N.
| Molecular formula | C18H20O3 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | (2R,3R)-2,3-bis(phenylmethoxymethyl)oxirane |
| InChIKey | BWXXSADMQUTHRY-QZTJIDSGSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H](O2)COCC3=CC=CC=C3 |
Computed by PubChem (NCBI)