CAS 132993-23-8 appears in our catalog under these names: 4-Fluorophenyl trifluoromethanesulfonate, 98%, 4-Fluorophenyltriflate 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.
(4-fluorophenyl) trifluoromethanesulfonate (CAS 132993-23-8) is a chemical compound with the molecular formula C7H4F4O3S and a molecular weight of 244.17 g/mol. IUPAC name: (4-fluorophenyl) trifluoromethanesulfonate. InChIKey: FEHSEZUGDOTYAE-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O3S |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | (4-fluorophenyl) trifluoromethanesulfonate |
| InChIKey | FEHSEZUGDOTYAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OS(=O)(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)