CAS 2070902-77-9 appears in our catalog under these names: Trifluoromethyl 4-fluorobenzenesulfonate 97%, Trifluoromethyl 4-fluorobenzenesulfonate, 97%, 97%, Trifluoromethyl 4-fluorobenzenesulfonate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 100mg, 10g.
Trifluoromethyl 4-fluorobenzenesulfonate (CAS 2070902-77-9) is a chemical compound with the molecular formula C7H4F4O3S and a molecular weight of 244.17 g/mol. IUPAC name: trifluoromethyl 4-fluorobenzenesulfonate. InChIKey: CEDNKWXPIPAZQP-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O3S |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | trifluoromethyl 4-fluorobenzenesulfonate |
| InChIKey | CEDNKWXPIPAZQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)OC(F)(F)F |
Computed by PubChem (NCBI)