CAS 1329992-97-3 is the registry number for tert-Butyl (S)-(1-(3,4-dichlorophenyl)-2-hydroxyethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]carbamate (CAS 1329992-97-3) is a chemical compound with the molecular formula C13H17Cl2NO3 and a molecular weight of 306.18 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]carbamate. InChIKey: MFPBLYXFTNGOTA-LLVKDONJSA-N.
| Molecular formula | C13H17Cl2NO3 |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]carbamate |
| InChIKey | MFPBLYXFTNGOTA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)