Products 1803599-10-1
CAS 1803599-10-1 is the registry number for 2,6-Dichloro-N,N-diethyl-3,5-dimethoxybenzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,6-dichloro-N,N-diethyl-3,5-dimethoxybenzamide (CAS 1803599-10-1) is a chemical compound with the molecular formula C13H17Cl2NO3 and a molecular weight of 306.18 g/mol. IUPAC name: 2,6-dichloro-N,N-diethyl-3,5-dimethoxybenzamide. InChIKey: BTZKYTUQXMHAKJ-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO3 |
|---|---|
| Molecular weight | 306.18 g/mol |
| IUPAC name | 2,6-dichloro-N,N-diethyl-3,5-dimethoxybenzamide |
| InChIKey | BTZKYTUQXMHAKJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C(=CC(=C1Cl)OC)OC)Cl |
Computed by PubChem (NCBI)