Products 1330046-00-8
CAS 1330046-00-8 is the registry number for Des(1-cyclohexanol) Venlafaxine-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg.
2-(4-methoxyphenyl)-N,N-bis(trideuteriomethyl)ethanamine (CAS 1330046-00-8) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 185.30 g/mol. IUPAC name: 2-(4-methoxyphenyl)-N,N-bis(trideuteriomethyl)ethanamine. InChIKey: BGSZBHCYLIHECZ-WFGJKAKNSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 185.30 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-N,N-bis(trideuteriomethyl)ethanamine |
| InChIKey | BGSZBHCYLIHECZ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC1=CC=C(C=C1)OC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)