CAS 133005-85-3 is the registry number for Isodomoic acid E. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,3S,4S)-4-[(2E,4E,6R)-6-carboxyhepta-2,4-dien-2-yl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid (CAS 133005-85-3) is a chemical compound with the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. IUPAC name: (2S,3S,4S)-4-[(2E,4E,6R)-6-carboxyhepta-2,4-dien-2-yl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid. InChIKey: VZFRNCSOCOPNDB-JIUSADRUSA-N.
| Molecular formula | C15H21NO6 |
|---|---|
| Molecular weight | 311.33 g/mol |
| IUPAC name | (2S,3S,4S)-4-[(2E,4E,6R)-6-carboxyhepta-2,4-dien-2-yl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid |
| InChIKey | VZFRNCSOCOPNDB-JIUSADRUSA-N |
| SMILES | C[C@H](/C=C/C=C(\C)/[C@H]1CN[C@@H]([C@H]1CC(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)