CAS 1330166-04-5 appears in our catalog under these names: 7-Acetamido-d3 Clonazepam, 7–Acetamido–d3 Clonazepam, 7-Acetamido Clonazepam-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
N-[5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-7-yl]-2,2,2-trideuterioacetamide (CAS 1330166-04-5) is a chemical compound with the molecular formula C17H14ClN3O2 and a molecular weight of 330.8 g/mol. IUPAC name: N-[5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-7-yl]-2,2,2-trideuterioacetamide. InChIKey: CSSPKOOFFDJUJC-FIBGUPNXSA-N.
| Molecular formula | C17H14ClN3O2 |
|---|---|
| Molecular weight | 330.8 g/mol |
| IUPAC name | N-[5-(2-chlorophenyl)-2-oxo-1,3-dihydro-1,4-benzodiazepin-7-yl]-2,2,2-trideuterioacetamide |
| InChIKey | CSSPKOOFFDJUJC-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=CC2=C(C=C1)NC(=O)CN=C2C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)