Products 851030-18-7
CAS 851030-18-7 appears in our catalog under these names: 2,4-Bis(benzyloxy)-6-chloro-1,3,5-triazine, 98%, 2,4-Bis(benzyloxy)-6-chloro-1,3,5-triazine, 95% HPLC,T, 2,4–Bis(benzyloxy)–6–chloro–1,3,5–triazine, 2,4-Bis(benzyloxy)-6-chloro-1,3,5-triazine, >95.0%(HPLC)(T), 2,4-Bis(benzyloxy)-6-chloro-1,3,5-triazine, 95.0%, 95.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 200mg, Get quote, 100mg.
2-chloro-4,6-bis(phenylmethoxy)-1,3,5-triazine (CAS 851030-18-7) is a chemical compound with the molecular formula C17H14ClN3O2 and a molecular weight of 327.8 g/mol. IUPAC name: 2-chloro-4,6-bis(phenylmethoxy)-1,3,5-triazine. InChIKey: XKDFUXJROYAXAO-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN3O2 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | 2-chloro-4,6-bis(phenylmethoxy)-1,3,5-triazine |
| InChIKey | XKDFUXJROYAXAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC(=N2)Cl)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)