CAS 1330173-07-3 is the registry number for 5-Chloro-3-(piperazin-1-yl)benzol(D)isothiazole. Offered by: Biosynth. Available pack sizes: 100mg.
5-chloro-3-piperazin-1-yl-1,2-benzothiazole (CAS 1330173-07-3) is a chemical compound with the molecular formula C11H12ClN3S and a molecular weight of 253.75 g/mol. IUPAC name: 5-chloro-3-piperazin-1-yl-1,2-benzothiazole. InChIKey: JKDFFXCLXIRDAK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3S |
|---|---|
| Molecular weight | 253.75 g/mol |
| IUPAC name | 5-chloro-3-piperazin-1-yl-1,2-benzothiazole |
| InChIKey | JKDFFXCLXIRDAK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NSC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)