CAS 2287318-91-4 is the registry number for 5-Chloro-1-(tetrahydro-2H-thiopyran-4-yl)-1H-benzo[d][1,2,3]triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-1-(thian-4-yl)benzotriazole (CAS 2287318-91-4) is a chemical compound with the molecular formula C11H12ClN3S and a molecular weight of 253.75 g/mol. IUPAC name: 5-chloro-1-(thian-4-yl)benzotriazole. InChIKey: OBVFUCSSLCODLS-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3S |
|---|---|
| Molecular weight | 253.75 g/mol |
| IUPAC name | 5-chloro-1-(thian-4-yl)benzotriazole |
| InChIKey | OBVFUCSSLCODLS-UHFFFAOYSA-N |
| SMILES | C1CSCCC1N2C3=C(C=C(C=C3)Cl)N=N2 |
Computed by PubChem (NCBI)