Products 1330188-81-2
CAS 1330188-81-2 appears in our catalog under these names: 1-Benzhydrylpiperazine-d8, >95% (HPLC), 1–Benzhydrylpiperazine–d8, Norcyclizine-d8. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 5 mg, 50 mg.
1-benzhydryl-2,2,3,3,5,5,6,6-octadeuteriopiperazine (CAS 1330188-81-2) is a chemical compound with the molecular formula C17H20N2 and a molecular weight of 260.40 g/mol. IUPAC name: 1-benzhydryl-2,2,3,3,5,5,6,6-octadeuteriopiperazine. InChIKey: NWVNXDKZIQLBNM-FUEQIQQISA-N.
| Molecular formula | C17H20N2 |
|---|---|
| Molecular weight | 260.40 g/mol |
| IUPAC name | 1-benzhydryl-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| InChIKey | NWVNXDKZIQLBNM-FUEQIQQISA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(C2=CC=CC=C2)C3=CC=CC=C3)([2H])[2H])[2H] |
Computed by PubChem (NCBI)