CAS 1330238-27-1 is the registry number for 2-Phenylpropionitrile-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-(2,3,4,5,6-pentadeuteriophenyl)propanenitrile (CAS 1330238-27-1) is a chemical compound with the molecular formula C9H9N and a molecular weight of 136.20 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenyl)propanenitrile. InChIKey: NVAOLENBKNECGF-VIQYUKPQSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 136.20 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenyl)propanenitrile |
| InChIKey | NVAOLENBKNECGF-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)C#N)[2H])[2H] |
Computed by PubChem (NCBI)