Products 1330261-26-1
CAS 1330261-26-1 is the registry number for Prothionamide-d5. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
2-(2,2,3,3,3-pentadeuteriopropyl)pyridine-4-carbothioamide (CAS 1330261-26-1) is a chemical compound with the molecular formula C9H12N2S and a molecular weight of 185.30 g/mol. IUPAC name: 2-(2,2,3,3,3-pentadeuteriopropyl)pyridine-4-carbothioamide. InChIKey: VRDIULHPQTYCLN-ZBJDZAJPSA-N.
| Molecular formula | C9H12N2S |
|---|---|
| Molecular weight | 185.30 g/mol |
| IUPAC name | 2-(2,2,3,3,3-pentadeuteriopropyl)pyridine-4-carbothioamide |
| InChIKey | VRDIULHPQTYCLN-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CC1=NC=CC(=C1)C(=S)N |
Computed by PubChem (NCBI)
Synonyms:
Prothionamide-d5, Protionamide-d5