CAS 2468639-68-9 is the registry number for Protionamide-d7, 97.17%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyridine-4-carbothioamide (CAS 2468639-68-9) is a chemical compound with the molecular formula C9H12N2S and a molecular weight of 187.32 g/mol. IUPAC name: 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyridine-4-carbothioamide. InChIKey: VRDIULHPQTYCLN-NCKGIQLSSA-N.
| Molecular formula | C9H12N2S |
|---|---|
| Molecular weight | 187.32 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)pyridine-4-carbothioamide |
| InChIKey | VRDIULHPQTYCLN-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC=CC(=C1)C(=S)N |
Computed by PubChem (NCBI)