Products 1330261-33-0
CAS 1330261-33-0 is the registry number for Rabeprazole EP Impurity A-d3 (Rabeprazole Sulfone-d3). Offered by: Chemat Brand. Available pack sizes: on request.
2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfonyl]-1H-benzimidazole (CAS 1330261-33-0) is a chemical compound with the molecular formula C18H21N3O4S and a molecular weight of 378.5 g/mol. IUPAC name: 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfonyl]-1H-benzimidazole. InChIKey: KNYNPBSPFHFPML-BMSJAHLVSA-N.
| Molecular formula | C18H21N3O4S |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfonyl]-1H-benzimidazole |
| InChIKey | KNYNPBSPFHFPML-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OCCCOC1=C(C(=NC=C1)CS(=O)(=O)C2=NC3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)
Synonyms:
Rabeprazole Sulfone-d3