CAS 924663-38-7 appears in our catalog under these names: Rabeprazole EP Impurity D, Rabeprazole N-Oxide, Rabeprazole N-Oxide, >95% (HPLC), RABEPRAZOLE N-OXIDE, 98%, 98%. Offered by: Chemat Brand, Mikromol, TRC, Chemat. Available pack sizes: on request, 25mg, 100mg, 5mg.
2-[[4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole (CAS 924663-38-7) is a chemical compound with the molecular formula C18H21N3O4S and a molecular weight of 375.4 g/mol. IUPAC name: 2-[[4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole. InChIKey: ZOEQFVVMBAVTRU-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O4S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-[[4-(3-methoxypropoxy)-3-methyl-1-oxidopyridin-1-ium-2-yl]methylsulfinyl]-1H-benzimidazole |
| InChIKey | ZOEQFVVMBAVTRU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1CS(=O)C2=NC3=CC=CC=C3N2)[O-])OCCCOC |
Computed by PubChem (NCBI)