Products 1330267-27-0
CAS 1330267-27-0 appears in our catalog under these names: Apomorphine 10-O-Sulfate, (R)-Apomorphine-10-sulfate (1mg/ml in Acetonitrile), (R)-Apomorphine-10-sulfate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1x1ml, 10mg, 1mg.
[(6aR)-11-hydroxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] hydrogen sulfate (CAS 1330267-27-0) is a chemical compound with the molecular formula C17H17NO5S and a molecular weight of 347.4 g/mol. IUPAC name: [(6aR)-11-hydroxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] hydrogen sulfate. InChIKey: IHOVAMLPXSKBSG-CYBMUJFWSA-N.
| Molecular formula | C17H17NO5S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | [(6aR)-11-hydroxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] hydrogen sulfate |
| InChIKey | IHOVAMLPXSKBSG-CYBMUJFWSA-N |
| SMILES | CN1CCC2=C3[C@H]1CC4=C(C3=CC=C2)C(=C(C=C4)OS(=O)(=O)O)O |
Computed by PubChem (NCBI)