Products 2512213-31-7
CAS 2512213-31-7 is the registry number for 2-(3,5-Diformyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-[3,5-diformyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 2512213-31-7) is a chemical compound with the molecular formula C17H17NO5S and a molecular weight of 347.4 g/mol. IUPAC name: 2-[3,5-diformyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: WTQZOJFVCIVSQN-UHFFFAOYSA-N.
| Molecular formula | C17H17NO5S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 2-[3,5-diformyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WTQZOJFVCIVSQN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C(=C2)C=O)OCC(C)C)C=O)C(=O)O |
Computed by PubChem (NCBI)