CAS 133053-45-9 is the registry number for 3-Bromo-1-methyl-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
3-bromo-1-methyl-4-(1-methylindol-3-yl)pyrrole-2,5-dione (CAS 133053-45-9) is a chemical compound with the molecular formula C14H11BrN2O2 and a molecular weight of 319.15 g/mol. IUPAC name: 3-bromo-1-methyl-4-(1-methylindol-3-yl)pyrrole-2,5-dione. InChIKey: SXTNKNUQBVHICU-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O2 |
|---|---|
| Molecular weight | 319.15 g/mol |
| IUPAC name | 3-bromo-1-methyl-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| InChIKey | SXTNKNUQBVHICU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)N(C3=O)C)Br |
Computed by PubChem (NCBI)