Products 34592-41-1
CAS 34592-41-1 is the registry number for 1-(5-bromo-1-naphthyl)hexahydropyrimidine-2,4-dione, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1-(5-bromonaphthalen-1-yl)-1,3-diazinane-2,4-dione (CAS 34592-41-1) is a chemical compound with the molecular formula C14H11BrN2O2 and a molecular weight of 319.15 g/mol. IUPAC name: 1-(5-bromonaphthalen-1-yl)-1,3-diazinane-2,4-dione. InChIKey: VVOSTWVXAYBREK-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O2 |
|---|---|
| Molecular weight | 319.15 g/mol |
| IUPAC name | 1-(5-bromonaphthalen-1-yl)-1,3-diazinane-2,4-dione |
| InChIKey | VVOSTWVXAYBREK-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC=CC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)