Products 1330626-14-6
CAS 1330626-14-6 is the registry number for tert-Butyl 3-bromo-1H-pyrazolo[4,3-b]pyridine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromopyrazolo[4,3-b]pyridine-1-carboxylate (CAS 1330626-14-6) is a chemical compound with the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. IUPAC name: tert-butyl 3-bromopyrazolo[4,3-b]pyridine-1-carboxylate. InChIKey: WWHYDLBBHNIORM-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O2 |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | tert-butyl 3-bromopyrazolo[4,3-b]pyridine-1-carboxylate |
| InChIKey | WWHYDLBBHNIORM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C(=N1)Br)N=CC=C2 |
Computed by PubChem (NCBI)