Products 2446914-42-5
CAS 2446914-42-5 is the registry number for 3-((6-Bromo-1-methyl-1H-indazol-3-yl)amino)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(6-bromo-1-methylindazol-3-yl)amino]propanoic acid (CAS 2446914-42-5) is a chemical compound with the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. IUPAC name: 3-[(6-bromo-1-methylindazol-3-yl)amino]propanoic acid. InChIKey: IUFBJEMQMMJUEP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3O2 |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 3-[(6-bromo-1-methylindazol-3-yl)amino]propanoic acid |
| InChIKey | IUFBJEMQMMJUEP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=N1)NCCC(=O)O |
Computed by PubChem (NCBI)