CAS 1330750-45-2 is the registry number for 3-Chloro-4-methyl-2,6-dinitrophenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-chloro-4-methyl-2,6-dinitrophenol (CAS 1330750-45-2) is a chemical compound with the molecular formula C7H5ClN2O5 and a molecular weight of 232.58 g/mol. IUPAC name: 3-chloro-4-methyl-2,6-dinitrophenol. InChIKey: SSFPPEHPQLGLCK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O5 |
|---|---|
| Molecular weight | 232.58 g/mol |
| IUPAC name | 3-chloro-4-methyl-2,6-dinitrophenol |
| InChIKey | SSFPPEHPQLGLCK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)