CAS 55289-27-5 is the registry number for 3-Chloro-2-methyl-4,6-dinitrophenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-chloro-2-methyl-4,6-dinitrophenol (CAS 55289-27-5) is a chemical compound with the molecular formula C7H5ClN2O5 and a molecular weight of 232.58 g/mol. IUPAC name: 3-chloro-2-methyl-4,6-dinitrophenol. InChIKey: IWXOKGBLUVSBSO-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O5 |
|---|---|
| Molecular weight | 232.58 g/mol |
| IUPAC name | 3-chloro-2-methyl-4,6-dinitrophenol |
| InChIKey | IWXOKGBLUVSBSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)[N+](=O)[O-])[N+](=O)[O-])O |
Computed by PubChem (NCBI)