Products 1330756-16-5

CAS 1330756-16-5 appears in our catalog under these names: 1,4-Dioxan-2-ylmethanesulfonyl chloride, 95%, (1,4-Dioxan-2-yl)methanesulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 2g.

Structural formula: {0} (CAS {1})

1,4-dioxan-2-ylmethanesulfonyl chloride (CAS 1330756-16-5) is a chemical compound with the molecular formula C5H9ClO4S and a molecular weight of 200.64 g/mol. IUPAC name: 1,4-dioxan-2-ylmethanesulfonyl chloride. InChIKey: RYHNSCZLGCNGKW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO4S
Molecular weight200.64 g/mol
IUPAC name1,4-dioxan-2-ylmethanesulfonyl chloride
InChIKeyRYHNSCZLGCNGKW-UHFFFAOYSA-N
SMILESC1COC(CO1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)