Products 1600291-93-7

CAS 1600291-93-7 is the registry number for 2-(Oxetan-3-yloxy)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(oxetan-3-yloxy)ethanesulfonyl chloride (CAS 1600291-93-7) is a chemical compound with the molecular formula C5H9ClO4S and a molecular weight of 200.64 g/mol. IUPAC name: 2-(oxetan-3-yloxy)ethanesulfonyl chloride. InChIKey: KNIGUSGQMKQBLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO4S
Molecular weight200.64 g/mol
IUPAC name2-(oxetan-3-yloxy)ethanesulfonyl chloride
InChIKeyKNIGUSGQMKQBLZ-UHFFFAOYSA-N
SMILESC1C(CO1)OCCS(=O)(=O)Cl

Computed by PubChem (NCBI)