CAS 1330764-78-7 is the registry number for Cis-6,6-difluoro-3-azabicyclo[3.2.0]heptane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1S,5R)-6,6-difluoro-3-azabicyclo[3.2.0]heptane (CAS 1330764-78-7) is a chemical compound with the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. IUPAC name: (1S,5R)-6,6-difluoro-3-azabicyclo[3.2.0]heptane. InChIKey: GETFYARBJRZNMZ-UHNVWZDZSA-N.
| Molecular formula | C6H9F2N |
|---|---|
| Molecular weight | 133.14 g/mol |
| IUPAC name | (1S,5R)-6,6-difluoro-3-azabicyclo[3.2.0]heptane |
| InChIKey | GETFYARBJRZNMZ-UHNVWZDZSA-N |
| SMILES | C1[C@@H]2CNC[C@@H]2C1(F)F |
Computed by PubChem (NCBI)