CAS 1932129-06-0 is the registry number for (1S,4S)-5,5-Difluoro-2-azabicyclo[2.2.1]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane (CAS 1932129-06-0) is a chemical compound with the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. IUPAC name: (1S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane. InChIKey: SLDUOYYMBGNRCP-WHFBIAKZSA-N.
| Molecular formula | C6H9F2N |
|---|---|
| Molecular weight | 133.14 g/mol |
| IUPAC name | (1S,4S)-5,5-difluoro-2-azabicyclo[2.2.1]heptane |
| InChIKey | SLDUOYYMBGNRCP-WHFBIAKZSA-N |
| SMILES | C1[C@H]2CC([C@@H]1CN2)(F)F |
Computed by PubChem (NCBI)