CAS 133082-13-0 appears in our catalog under these names: (S)–(+)–1–(2–Chlorophenyl)–1,2–ethanediol, (1S)-1-(2-chlorophenyl)ethane-1,2-diol 97%, (S)-(+)-1-(2-Chlorophenyl)-1,2-ethanediol, 97%, 97%, (S)-(+)-1-(2-Chlorophenyl)-1,2-ethanediol, 97%+,RG. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
(1S)-1-(2-chlorophenyl)ethane-1,2-diol (CAS 133082-13-0) is a chemical compound with the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. IUPAC name: (1S)-1-(2-chlorophenyl)ethane-1,2-diol. InChIKey: YGOPULMDEZVJGI-MRVPVSSYSA-N.
| Molecular formula | C8H9ClO2 |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | (1S)-1-(2-chlorophenyl)ethane-1,2-diol |
| InChIKey | YGOPULMDEZVJGI-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CO)O)Cl |
Computed by PubChem (NCBI)