Products 133124-30-8

CAS 133124-30-8 is the registry number for (1S,2R)-2-Propylcyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Trans-(1S,2R)-2-propylcyclopropane-1-carboxylic acid (CAS 133124-30-8) is a chemical compound with the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. IUPAC name: trans-(1S,2R)-2-propylcyclopropane-1-carboxylic acid. InChIKey: VGXKFXUFNJJDGP-RITPCOANSA-N.

Identity
Molecular formulaC7H12O2
Molecular weight128.17 g/mol
IUPAC nametrans-(1S,2R)-2-propylcyclopropane-1-carboxylic acid
InChIKeyVGXKFXUFNJJDGP-RITPCOANSA-N
SMILESCCC[C@@H]1C[C@@H]1C(=O)O

Computed by PubChem (NCBI)