Products 1392481-20-7

CAS 1392481-20-7 is the registry number for (1R,2S)-2-Propylcyclopropanecarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Trans-(1R,2S)-2-propylcyclopropane-1-carboxylic acid (CAS 1392481-20-7) is a chemical compound with the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. IUPAC name: trans-(1R,2S)-2-propylcyclopropane-1-carboxylic acid. InChIKey: VGXKFXUFNJJDGP-NTSWFWBYSA-N.

Identity
Molecular formulaC7H12O2
Molecular weight128.17 g/mol
IUPAC nametrans-(1R,2S)-2-propylcyclopropane-1-carboxylic acid
InChIKeyVGXKFXUFNJJDGP-NTSWFWBYSA-N
SMILESCCC[C@H]1C[C@H]1C(=O)O

Computed by PubChem (NCBI)