Products 133163-28-7
CAS 133163-28-7 appears in our catalog under these names: Midodrine hydrochloride, (R)-Midodrine (hydrochloride). Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, Get quote.
2-amino-N-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride (CAS 133163-28-7) is a chemical compound with the molecular formula C12H19ClN2O4 and a molecular weight of 290.74 g/mol. IUPAC name: 2-amino-N-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride. InChIKey: MGCQZNBCJBRZDT-PPHPATTJSA-N.
| Molecular formula | C12H19ClN2O4 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 2-amino-N-[(2R)-2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride |
| InChIKey | MGCQZNBCJBRZDT-PPHPATTJSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)[C@H](CNC(=O)CN)O.Cl |
Computed by PubChem (NCBI)