Products 1331642-74-0
CAS 1331642-74-0 is the registry number for Ethyl Arachidonate-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1,1,2,2,2-pentadeuterioethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (CAS 1331642-74-0) is a chemical compound with the molecular formula C22H36O2 and a molecular weight of 337.5 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate. InChIKey: SNXPWYFWAZVIAU-DJRYQXLJSA-N.
| Molecular formula | C22H36O2 |
|---|---|
| Molecular weight | 337.5 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| InChIKey | SNXPWYFWAZVIAU-DJRYQXLJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
Computed by PubChem (NCBI)