CAS 60437-17-4 is the registry number for Ethyl 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate (CAS 60437-17-4) is a chemical compound with the molecular formula C22H36O2 and a molecular weight of 332.5 g/mol. IUPAC name: ethyl (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate. InChIKey: BFYVSGCRUDETNO-JYQWTDEISA-N.
| Molecular formula | C22H36O2 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | ethyl (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
| InChIKey | BFYVSGCRUDETNO-JYQWTDEISA-N |
| SMILES | CCOC(=O)/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)