CAS 1331655-50-5 appears in our catalog under these names: Acepromazine-d6 Maleate, >95% (HPLC), Acepromazine D6 maleate, Acepromazine–d6 Maleate, Acepromazine-d6 (maleate), D6-Acepromazine maleate, Concentration: 100 µg/ml Solvent: Water. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 50mg, 10 mg, 1 mg, 1x1ml, 1x10mg.
1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone;(Z)-but-2-enedioic acid (CAS 1331655-50-5) is a chemical compound with the molecular formula C23H26N2O5S and a molecular weight of 448.6 g/mol. IUPAC name: 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone;(Z)-but-2-enedioic acid. InChIKey: FQRHOOHLUYHMGG-XJONCRCBSA-N.
| Molecular formula | C23H26N2O5S |
|---|---|
| Molecular weight | 448.6 g/mol |
| IUPAC name | 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone;(Z)-but-2-enedioic acid |
| InChIKey | FQRHOOHLUYHMGG-XJONCRCBSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)C(=O)C)C([2H])([2H])[2H].C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)