CAS 3598-37-6 appears in our catalog under these names: Acepromazine maleate, 97%, Acepromazine Maleate, Acepromazine Maleate, >95% (HPLC), Acepromazine (maleate), ACEPROMAZINE MALEATE/ 98.87% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 5g, 250mg, 1g, 100mg, on request, 10mg, 25mg, 50mg.
(Z)-but-2-enedioic acid;1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanone (CAS 3598-37-6) is a chemical compound with the molecular formula C23H26N2O5S and a molecular weight of 442.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanone. InChIKey: FQRHOOHLUYHMGG-BTJKTKAUSA-N.
| Molecular formula | C23H26N2O5S |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanone |
| InChIKey | FQRHOOHLUYHMGG-BTJKTKAUSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)