Products 1404475-07-5
CAS 1404475-07-5 is the registry number for Ethyl linoleate-d2. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Ethyl (9Z,12Z)-11,11-dideuteriooctadeca-9,12-dienoate (CAS 1404475-07-5) is a chemical compound with the molecular formula C20H36O2 and a molecular weight of 310.5 g/mol. IUPAC name: ethyl (9Z,12Z)-11,11-dideuteriooctadeca-9,12-dienoate. InChIKey: FMMOOAYVCKXGMF-XMCVDNGOSA-N.
| Molecular formula | C20H36O2 |
|---|---|
| Molecular weight | 310.5 g/mol |
| IUPAC name | ethyl (9Z,12Z)-11,11-dideuteriooctadeca-9,12-dienoate |
| InChIKey | FMMOOAYVCKXGMF-XMCVDNGOSA-N |
| SMILES | [2H]C([2H])(/C=C\CCCCC)/C=C\CCCCCCCC(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Deulinoleate ethyl, ethyl (9Z,12Z)-octadeca-9,12-dienoate-11,11-d2, 9,12-Octadecadienoic-11,11-d2 acid, ethyl ester, (9Z,12Z)-, Ethyl linoleate-d2, Deulinoleate ethyl [USAN], Deulinoleate ethyl (USAN), 9-cis, 12-cis-11,11-D2-Linoleic acid ethyl ester, Ethyl (9Z,12Z)-9,12-octadecadienoate-11,11-d2, ethyl (9Z,12Z)-11,11-dideuteriooctadeca-9,12-dienoate, Ethyl (9Z,12Z)-(11,11-~2~H_2_)octadeca-9,12-dienoate