Products 1331908-61-2
CAS 1331908-61-2 appears in our catalog under these names: L-Citrulline-d6, >95% (HPLC), L–Citrulline–d6, L-Citrulline-d6. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500μg, 1mg, 500 μg.
(2S)-2-amino-5-(carbamoylamino)-3,3,4,4,5,5-hexadeuteriopentanoic acid (CAS 1331908-61-2) is a chemical compound with the molecular formula C6H13N3O3 and a molecular weight of 181.22 g/mol. IUPAC name: (2S)-2-amino-5-(carbamoylamino)-3,3,4,4,5,5-hexadeuteriopentanoic acid. InChIKey: RHGKLRLOHDJJDR-UJSKYATRSA-N.
| Molecular formula | C6H13N3O3 |
|---|---|
| Molecular weight | 181.22 g/mol |
| IUPAC name | (2S)-2-amino-5-(carbamoylamino)-3,3,4,4,5,5-hexadeuteriopentanoic acid |
| InChIKey | RHGKLRLOHDJJDR-UJSKYATRSA-N |
| SMILES | [2H]C([2H])([C@@H](C(=O)O)N)C([2H])([2H])C([2H])([2H])NC(=O)N |
Computed by PubChem (NCBI)