CAS 172491-18-8 is the registry number for (R)-5-((Aminoiminomethyl)amino)-2-hydroxy-pentanoic Acid. Offered by: TRC. Available pack sizes: 250mg.
(2R)-5-(diaminomethylideneamino)-2-hydroxypentanoic acid (CAS 172491-18-8) is a chemical compound with the molecular formula C6H13N3O3 and a molecular weight of 175.19 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-hydroxypentanoic acid. InChIKey: BMFMQGXDDJALKQ-SCSAIBSYSA-N.
| Molecular formula | C6H13N3O3 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-hydroxypentanoic acid |
| InChIKey | BMFMQGXDDJALKQ-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)O)O)CN=C(N)N |
Computed by PubChem (NCBI)