CAS 1331909-07-9 appears in our catalog under these names: N-Acetyl-S-(2,5-dimethylbenzene)-L-cysteine-d3, N–Acetyl–S–(2,5–dimethylbenzene)–L–cysteine–d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg, 10 mg.
(2R)-3-(2,5-dimethylphenyl)sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 1331909-07-9) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 270.36 g/mol. IUPAC name: (2R)-3-(2,5-dimethylphenyl)sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: PMCBFFLCBUOZER-NQNNWHPSSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 270.36 g/mol |
| IUPAC name | (2R)-3-(2,5-dimethylphenyl)sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | PMCBFFLCBUOZER-NQNNWHPSSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSC1=C(C=CC(=C1)C)C)C(=O)O |
Computed by PubChem (NCBI)