Products 1331959-78-4
CAS 1331959-78-4 is the registry number for HAC-Y6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[9-[(3,4,5-trimethoxyphenyl)methyl]pyrido[2,3-b]indol-6-yl]ethanone (CAS 1331959-78-4) is a chemical compound with the molecular formula C23H22N2O4 and a molecular weight of 390.4 g/mol. IUPAC name: 1-[9-[(3,4,5-trimethoxyphenyl)methyl]pyrido[2,3-b]indol-6-yl]ethanone. InChIKey: NYMMDHGEECPYAW-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 1-[9-[(3,4,5-trimethoxyphenyl)methyl]pyrido[2,3-b]indol-6-yl]ethanone |
| InChIKey | NYMMDHGEECPYAW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N(C3=C2C=CC=N3)CC4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)