Products 2414629-92-6
CAS 2414629-92-6 is the registry number for hCAXII-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[5-(4-tert-butylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]-4-methylchromen-2-one (CAS 2414629-92-6) is a chemical compound with the molecular formula C23H22N2O4 and a molecular weight of 390.4 g/mol. IUPAC name: 7-[[5-(4-tert-butylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]-4-methylchromen-2-one. InChIKey: DFGYRSAGPYIEPW-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 7-[[5-(4-tert-butylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]-4-methylchromen-2-one |
| InChIKey | DFGYRSAGPYIEPW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC3=NOC(=N3)C4=CC=C(C=C4)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
hCAXII-IN-5, orb1688269