CAS 1332334-01-6 is the registry number for 1-(2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (CAS 1332334-01-6) is a chemical compound with the molecular formula C15H18BFN2O2 and a molecular weight of 288.13 g/mol. IUPAC name: 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole. InChIKey: FURIQXLHGXJAKZ-UHFFFAOYSA-N.
| Molecular formula | C15H18BFN2O2 |
|---|---|
| Molecular weight | 288.13 g/mol |
| IUPAC name | 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| InChIKey | FURIQXLHGXJAKZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N3C=CC=N3)F |
Computed by PubChem (NCBI)