CAS 1402240-90-7 is the registry number for 1-(3-Fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(3-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1402240-90-7) is a chemical compound with the molecular formula C15H18BFN2O2 and a molecular weight of 288.13 g/mol. IUPAC name: 1-(3-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: JJSYZUVKCDQDNV-UHFFFAOYSA-N.
| Molecular formula | C15H18BFN2O2 |
|---|---|
| Molecular weight | 288.13 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | JJSYZUVKCDQDNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)